|
|
| | Ethyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate Basic information |
| Product Name: | Ethyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate | | Synonyms: | 2-Phenyl-1.3.4-oxdiazol-carbonsaeure-(5)-aethylester;JR-13708, Ethyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate, 97%;5-Phenyl-[1,3,4]oxadiazole-2-carboxylic acid ethyl ester;1,3,4-Oxadiazole-2-carboxylic acid, 5-phenyl-, ethyl ester;KML-69;KML-101;Ethyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate | | CAS: | 16691-25-1 | | MF: | C11H10N2O3 | | MW: | 218.21 | | EINECS: | | | Product Categories: | | | Mol File: | 16691-25-1.mol |  |
| | Ethyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate Chemical Properties |
| Melting point | 70-72 °C | | Boiling point | 342.9±25.0 °C(Predicted) | | density | 1.223±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | -4.78±0.10(Predicted) | | form | solid | | Appearance | Off-white to light yellow Solid | | InChI | 1S/C11H10N2O3/c1-2-15-11(14)10-13-12-9(16-10)8-6-4-3-5-7-8/h3-7H,2H2,1H3 | | InChIKey | IHWHTIPPAPNKLN-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1nnc(o1)-c2ccccc2 |
| WGK Germany | 3 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | Ethyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate Usage And Synthesis |
| | Ethyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate Preparation Products And Raw materials |
|