| Company Name: |
Hubei Moco Chemical Co., Ltd. Gold
|
| Tel: |
18627753421; 18627756402 |
| Email: |
3001051413@qq.com |
| Products Intro: |
Product Name:Probucol Impurity 30 CAS:4673-51-2 Purity:95% HPLC Package:50mg;100mg;200mg;500mg
|
| Company Name: |
Qingdao Riverside New Materials Co., Ltd.
|
| Tel: |
0532-80932738 15689126900 |
| Email: |
info@rivmat.com |
| Products Intro: |
Product Name:4,4′-Thiobis(2,6-di-tert-butylphenol) CAS:4673-51-2 Purity:99% HPLC Package:100G;1KG;5KG
|
| Company Name: |
SHENZHEN PHYSTANDARD BIO-TECH CO.,LTD
|
| Tel: |
0755-83725350 13380397412 |
| Email: |
3001280422@qq.com |
| Products Intro: |
Product Name:Probucol Impurity 18 CAS:4673-51-2 Purity:95%+ HPLC Package:5MG;50MG;100MG;500MG;1000MG
|
| Company Name: |
Molcoo Chemicals Inc.
|
| Tel: |
18627923403 |
| Email: |
3001039764@qq.com |
| Products Intro: |
Product Name: Probucol Impurity 30 CAS:4673-51-2 Purity:95 Package:100mg
|
4,4''-THIODI(2,6-DI-TERT-BUTYLPHENOL) manufacturers
|
| | 4,4''-THIODI(2,6-DI-TERT-BUTYLPHENOL) Basic information |
| Product Name: | 4,4''-THIODI(2,6-DI-TERT-BUTYLPHENOL) | | Synonyms: | 4,4''-THIODI(2,6-DI-TERT-BUTYLPHENOL);4,4zzhlxy-Thiodi(2,6-di-tert-butylphenol);Phenol, 4,4'-thiobis[2,6-bis(1,1-dimethylethyl)-;Probucol Impurity 30 | | CAS: | 4673-51-2 | | MF: | C28H42O2S | | MW: | 442.7 | | EINECS: | | | Product Categories: | | | Mol File: | 4673-51-2.mol |  |
| | 4,4''-THIODI(2,6-DI-TERT-BUTYLPHENOL) Chemical Properties |
| Boiling point | 517.4±50.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | pka | 10.04±0.70(Predicted) | | InChI | InChI=1S/C28H42O2S/c1-25(2,3)19-13-17(14-20(23(19)29)26(4,5)6)31-18-15-21(27(7,8)9)24(30)22(16-18)28(10,11)12/h13-16,29-30H,1-12H3 | | InChIKey | DQSYGNJXYMAPMV-UHFFFAOYSA-N | | SMILES | S(C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1)C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 |
| | 4,4''-THIODI(2,6-DI-TERT-BUTYLPHENOL) Usage And Synthesis |
| | 4,4''-THIODI(2,6-DI-TERT-BUTYLPHENOL) Preparation Products And Raw materials |
|