| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(4-(4-Methoxyphenyl)thiophen-2-yl)methanol CAS:79757-72-5 Purity:(4-(4-Methoxyphenyl)thiophen-2-yl)methanol Package:1G Remarks:JRD1470-1G
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:(4-(4-Methoxyphenyl)thiophen-2-yl)methanol CAS:79757-72-5
|
| Company Name: |
Heterocyclics Inc
|
| Tel: |
732-444-6336 |
| Email: |
info@heterocyclics.com |
| Products Intro: |
Product Name:JR-9066, (4-(4-Methoxyphenyl)thiophen-2-yl)methanol, 97% CAS:79757-72-5
|
|
| | (4-(4-methoxyphenyl)thiophen-2-yl)methanol Basic information |
| | (4-(4-methoxyphenyl)thiophen-2-yl)methanol Chemical Properties |
| Boiling point | 340.8±37.0 °C(Predicted) | | density | 1.210±0.06 g/cm3(Predicted) | | pka | 13.79±0.10(Predicted) | | form | solid | | InChI | 1S/C12H12O2S/c1-14-11-4-2-9(3-5-11)10-6-12(7-13)15-8-10/h2-6,8,13H,7H2,1H3 | | InChIKey | YYWVWLFLZRRBPV-UHFFFAOYSA-N | | SMILES | OCC1=CC(C2=CC=C(OC)C=C2)=CS1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | (4-(4-methoxyphenyl)thiophen-2-yl)methanol Usage And Synthesis |
| | (4-(4-methoxyphenyl)thiophen-2-yl)methanol Preparation Products And Raw materials |
|