| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
|
| | 1-(4-(2,4-dichlorophenoxy)-3-nitrophenyl)ethanone Basic information |
| | 1-(4-(2,4-dichlorophenoxy)-3-nitrophenyl)ethanone Chemical Properties |
| form | solid | | InChI | 1S/C14H9Cl2NO4/c1-8(18)9-2-4-14(12(6-9)17(19)20)21-13-5-3-10(15)7-11(13)16/h2-7H,1H3 | | InChIKey | JAGHOGINQNAZKU-UHFFFAOYSA-N | | SMILES | CC(=O)c1ccc(Oc2ccc(Cl)cc2Cl)c(c1)[N+]([O-])=O |
| Hazard Codes | N | | Risk Statements | 41-43-50/53 | | Safety Statements | 26-36/37-39-60-61 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 |
| | 1-(4-(2,4-dichlorophenoxy)-3-nitrophenyl)ethanone Usage And Synthesis |
| | 1-(4-(2,4-dichlorophenoxy)-3-nitrophenyl)ethanone Preparation Products And Raw materials |
|