- DL-m-Tyrosine
-
- $15.00 / 1KG
-
2021-07-02
- CAS:775-06-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 3-(3-Hydroxyphenyl)-DL-alanine Basic information |
| | 3-(3-Hydroxyphenyl)-DL-alanine Chemical Properties |
| Melting point | 280-285 °C (dec.) (lit.) | | Boiling point | 314.29°C (rough estimate) | | density | 1.2375 (rough estimate) | | refractive index | 1.5270 (estimate) | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | Soluble in 1M HCl. | | pka | 2.20±0.10(Predicted) | | form | crystalline | | color | white to off-white | | Merck | 14,9839 | | BRN | 2416853 | | InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-2-1-3-7(11)4-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1 | | InChIKey | JZKXXXDKRQWDET-QMMMGPOBSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=CC(O)=C1)N | | CAS DataBase Reference | 775-06-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | RTECS | YP2278000 | | HS Code | 29225090 |
| | 3-(3-Hydroxyphenyl)-DL-alanine Usage And Synthesis |
| Chemical Properties | White crystals powder | | Uses | 3-(3-Hydroxyphenyl)-DL-alanine is used as a food and feed additive. It is also used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff. | | Uses | A precursor in the formation of catecholamines |
| | 3-(3-Hydroxyphenyl)-DL-alanine Preparation Products And Raw materials |
|