- BROMOETHANE-D5
-
- $1.00 / 1Kg
-
2024-07-20
- CAS:3675-63-6
- Min. Order: 1Kg
- Purity: 98%
- Supply Ability: 20T
- BROMOETHANE-D5
-
- $1.00 / 1g
-
2020-01-10
- CAS:3675-63-6
- Min. Order: 1g
- Purity: 99.0%
- Supply Ability: 100kg
|
| | BROMOETHANE-D5 Basic information |
| Product Name: | BROMOETHANE-D5 | | Synonyms: | BROMOETHANE-D5;ETHYL-D5 BROMIDE;bromoethane-[2H5];bromoethane-d599atom%d;Bromoethane-d5, 99 atom % D, stabilized, for NMR;Ethyl-d5 bromide, Pentadeuteroethyl bromide;(2H5)Ethyl bromide;1-Bromo(1,1,2,2,2-2H5)ethane | | CAS: | 3675-63-6 | | MF: | C2BrD5 | | MW: | 114 | | EINECS: | 222-944-4 | | Product Categories: | | | Mol File: | 3675-63-6.mol |  |
| | BROMOETHANE-D5 Chemical Properties |
| Melting point | -119 °C(lit.) | | Boiling point | 37-40 °C(lit.) | | density | 1.527 g/mL at 25 °C | | vapor pressure | 7.96 psi ( 20 °C) | | refractive index | n20/D 1.4205(lit.) | | Fp | −10 °F | | storage temp. | 2-8°C | | solubility | Acetonitrile, Chloroform, DMSO (Soluble), Methanol (Sligthly) | | form | Oil | | color | Colourless | | BRN | 1698455 | | InChI | InChI=1S/C2H5Br/c1-2-3/h2H2,1H3/i1D3,2D2 | | InChIKey | RDHPKYGYEGBMSE-ZBJDZAJPSA-N | | SMILES | C([2H])([2H])(C([2H])([2H])[2H])Br | | CAS DataBase Reference | 3675-63-6 | | CAS Number Unlabeled | 74-96-4 |
| Hazard Codes | Xn,F | | Risk Statements | 20/21/22-40-20/22-11 | | Safety Statements | 28-36/37 | | RIDADR | UN 1891 6.1/PG 2 | | WGK Germany | 3 | | F | 3-8-10 | | HazardClass | 3, 6.1 | | HS Code | 28459000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 2
Flam. Liq. 2
Ozone 1 |
| | BROMOETHANE-D5 Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | BROMOETHANE-D5, which is used in the synthesis of novel non-competitive antagonists of kainate Glu1/Glu2 receptors. It is used in the synthesis of tryptophan analogues. |
| | BROMOETHANE-D5 Preparation Products And Raw materials |
|