4-BROMO-3-PHENYL-1H-PYRAZOL-5-AMINE manufacturers
|
| | 4-BROMO-3-PHENYL-1H-PYRAZOL-5-AMINE Basic information |
| | 4-BROMO-3-PHENYL-1H-PYRAZOL-5-AMINE Chemical Properties |
| Melting point | 118-120 °C | | Boiling point | 438.5±45.0 °C(Predicted) | | density | 1.6399 (rough estimate) | | refractive index | 1.6900 (estimate) | | storage temp. | 2-8°C | | solubility | Methanol | | form | Solid | | pka | 13.51±0.50(Predicted) | | color | Off-White | | InChI | InChI=1S/C9H8BrN3/c10-7-8(12-13-9(7)11)6-4-2-1-3-5-6/h1-5H,(H3,11,12,13) | | InChIKey | QTNVXMOPTHGCII-UHFFFAOYSA-N | | SMILES | N1C(C2=CC=CC=C2)=C(Br)C(N)=N1 | | CAS DataBase Reference | 2845-78-5(CAS DataBase Reference) |
| | 4-BROMO-3-PHENYL-1H-PYRAZOL-5-AMINE Usage And Synthesis |
| Chemical Properties | Off-White Solid |
| | 4-BROMO-3-PHENYL-1H-PYRAZOL-5-AMINE Preparation Products And Raw materials |
|