|
|
| | 5-bromo-6-chloropyridin-2-amine Basic information | | Uses |
| Product Name: | 5-bromo-6-chloropyridin-2-amine | | Synonyms: | 5-bromo-6-chloropyridin-2-amine;6-Amino-2-chloro-3-bromopyridine;2-AMino-5-broMo-6-chloropyridine;5-BroMo-6-chloro-pyridin-2-ylaMine;2-Pyridinamine, 5-bromo-6-chloro-;2-amino-6-chloro-5-bromopyridine;5-bromo-6-chloropyridin-2-amine ISO 9001：2015 REACH | | CAS: | 358672-65-8 | | MF: | C5H4BrClN2 | | MW: | 207.46 | | EINECS: | 201-525-2 | | Product Categories: | | | Mol File: | 358672-65-8.mol |  |
| | 5-bromo-6-chloropyridin-2-amine Chemical Properties |
| Boiling point | 285℃ | | density | 1.834 | | Fp | 126℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 1.21±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H4BrClN2/c6-3-1-2-4(8)9-5(3)7/h1-2H,(H2,8,9) | | InChIKey | BUTBOALODZMXJV-UHFFFAOYSA-N | | SMILES | C1(N)=NC(Cl)=C(Br)C=C1 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | 2811 | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 2933399990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 5-bromo-6-chloropyridin-2-amine Usage And Synthesis |
| Uses | 2-Amino-6-chloro-5-bromopyridine can be used as a pharmaceutical synthesis intermediate. | | Synthesis | Weighed 6-chloro-pyridin-2-amine (2.58g,20.06mmol), added to N,N-dimethylformamide (25mL) was dissolved, weighed N-bromosuccinimide (3.56g,20.00mmol) was added to the above solution, and the reaction was done at room temperature for 0.5 hours. Water was added, extracted with ethyl acetate, the organic phase was washed with saturated brine, dried with anhydrous sodium sulfate, concentrated, and the crude product was purified by silica gel column chromatography (petroleum ether: ethyl acetate = 5:1) to give the title compound (3.60 g, 86.5% yield).
|
| | 5-bromo-6-chloropyridin-2-amine Preparation Products And Raw materials |
|