- Fmoc-L-Thr(bzl)-OH
-
- $0.00/ kg
-
2026-01-23
- CAS:117872-75-0
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- Fmoc-THr(Bzl)-OH
-
- $15.00 / 1KG
-
2021-08-11
- CAS:117872-75-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- Fmoc-THr(Bzl)-OH
-
- $1.00 / 1KG
-
2019-12-25
- CAS:117872-75-0
- Min. Order: 1KG
- Purity: 98%HPLC
- Supply Ability: 10t
|
| | Fmoc-THr(Bzl)-OH Basic information |
| | Fmoc-THr(Bzl)-OH Chemical Properties |
| Boiling point | 643.7±55.0 °C(Predicted) | | density | 1.257±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 3.39±0.10(Predicted) | | color | White | | BRN | 6353662 | | Major Application | peptide synthesis | | InChIKey | UCDMMWCWPVCHLL-OSPHWJPCSA-N | | SMILES | C[C@@H](OCc1ccccc1)[C@H](NC(=O)OCC2c3ccccc3-c4ccccc24)C(O)=O | | CAS DataBase Reference | 117872-75-0(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | Fmoc-THr(Bzl)-OH Usage And Synthesis |
| Uses | Fmoc-Thr(Bzl)-OH is a reagent used in the synthesis of thrombospondin-1 (TSR2) and associated peptide fragments. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-THr(Bzl)-OH Preparation Products And Raw materials |
|