|
|
| | 5-(TRIBUTYLSTANNYL)PYRIMIDINE Basic information |
| Product Name: | 5-(TRIBUTYLSTANNYL)PYRIMIDINE | | Synonyms: | 5-(TRIBUTYLSTANNYL)PYRIMIDINE;5-(tri-n-butylstannyl)pyrimidine;5-(tributyltin) pyrimidine;5-(tributylstannanyl)pyrimidine;Pyrimidine, 5-(tributylstannyl)-;5-(Tri-n-butylstannyl)pyrimidine,96%;SKL1011;tributyl(pyrimidin-5-yl)stannane | | CAS: | 144173-85-3 | | MF: | C16H30N2Sn | | MW: | 369.13 | | EINECS: | | | Product Categories: | Stannanes | | Mol File: | Mol File |  |
| | 5-(TRIBUTYLSTANNYL)PYRIMIDINE Chemical Properties |
| Boiling point | 134-138℃ (2 MMHG) | | density | 1.117 | | refractive index | 1.515 | | Fp | 110℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 1.79±0.10(Predicted) | | form | liquid | | Appearance | Light yellow to yellow Liquid | | InChI | 1S/C4H3N2.3C4H9.Sn/c1-2-5-4-6-3-1;3*1-3-4-2;/h2-4H;3*1,3-4H2,2H3; | | InChIKey | QRDQHTJNKPXXRQ-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1cncnc1 | | CAS DataBase Reference | 144173-85-3 |
| Hazard Codes | T,N | | Risk Statements | 21-25-36/38-48/23/25-50/53 | | Safety Statements | 35-36/37/39-45-60-61 | | RIDADR | UN 2788 | | WGK Germany | 3 | | HazardClass | 6.1 | | HS Code | 29335990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |
| | 5-(TRIBUTYLSTANNYL)PYRIMIDINE Usage And Synthesis |
| | 5-(TRIBUTYLSTANNYL)PYRIMIDINE Preparation Products And Raw materials |
|