|
|
| | Boc-L-2-allylglycine dicyclohexylamine salt Basic information |
| | Boc-L-2-allylglycine dicyclohexylamine salt Chemical Properties |
| Melting point | 117-123 °C | | storage temp. | Inert atmosphere,2-8°C | | form | Powder | | color | White to pale yellow | | Major Application | peptide synthesis | | InChI | 1S/C12H23N.C10H17NO4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-6-7(8(12)13)11-9(14)15-10(2,3)4/h11-13H,1-10H2;5,7H,1,6H2,2-4H3,(H,11,14)(H,12,13)/t;7-/m.0/s1 | | InChIKey | VMCGMPITVQIMGK-ZLTKDMPESA-N | | SMILES | C1CCC(CC1)NC2CCCCC2.CC(C)(C)OC(=O)N[C@@H](CC=C)C(O)=O | | CAS DataBase Reference | 143979-15-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 13 - Non Combustible Solids |
| | Boc-L-2-allylglycine dicyclohexylamine salt Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 2-Allyl-N-Boc-L-glycine dicyclohexylamine salt is used as pharmaceutical intermediate. |
| | Boc-L-2-allylglycine dicyclohexylamine salt Preparation Products And Raw materials |
|