|
|
| | 4-(FMOC-AMINOMETHYL)BENZOIC ACID Basic information |
| | 4-(FMOC-AMINOMETHYL)BENZOIC ACID Chemical Properties |
| Melting point | 224-228 °C | | Boiling point | 625.4±48.0 °C(Predicted) | | density | 1.296±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.24±0.10(Predicted) | | form | Powder | | color | White | | Water Solubility | Slightly soluble in water. | | BRN | 7391207 | | Major Application | peptide synthesis | | InChI | InChI=1S/C23H19NO4/c25-22(26)16-11-9-15(10-12-16)13-24-23(27)28-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21H,13-14H2,(H,24,27)(H,25,26) | | InChIKey | JRHUROPSUJVMNH-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(CNC(OCC2C3=C(C=CC=C3)C3=C2C=CC=C3)=O)C=C1 | | CAS DataBase Reference | 164470-64-8(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | 4-(FMOC-AMINOMETHYL)BENZOIC ACID Usage And Synthesis |
| Chemical Properties | white powder | | Uses | 4-(Fmoc-aminomethyl)benzoic acid is used as pharmaceutical intermediates. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | 4-(FMOC-AMINOMETHYL)BENZOIC ACID Preparation Products And Raw materials |
|