- halosulfuron-methyl
-
-
2026-04-17
- CAS:100784-20-1
- Min. Order: 1kg
- Purity: 99
- Supply Ability: 20tons
- Halosulfuron methyl
-
- $10.00
-
2026-03-20
- CAS:100784-20-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
|
| | Halosulfuron methyl Basic information |
| Product Name: | Halosulfuron methyl | | Synonyms: | Halosulfuron-Methy;Halosulfuron-m;-1-methyl-1H-pyrazole-4-carboxylate;Methyl 3-chloro-5-(N-((4,6-dimethoxypyrimidin-2-yl);sulfamoyl);3-Chloro-5-[[3-(4,6-dimethoxypyrimidin-2-yl)ureido]sulfonyl]-1-methyl-1H-pyrazole-4-carboxylic Acid Methyl Ester;Methyl 3-Chloro-5-[[3-(4,6-dimethoxypyrimidin-2-yl)ureido]sulfonyl]-1-methyl-1H-pyrazole-4-carboxylate;SEMPRA(R) | | CAS: | 100784-20-1 | | MF: | C13H15ClN6O7S | | MW: | 434.81 | | EINECS: | 600-130-3 | | Product Categories: | Herbicide;OLED | | Mol File: | 100784-20-1.mol |  |
| | Halosulfuron methyl Chemical Properties |
| Melting point | 175-177°C | | density | 1.618 | | storage temp. | 0-6°C | | Water Solubility | Insoluble in water | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | pka | 11.96±0.70(Predicted) | | color | White to Light yellow to Light orange | | Merck | 14,4602 | | Major Application | agriculture
environmental | | InChI | InChI=1S/C13H15ClN6O7S/c1-20-10(8(9(14)18-20)11(21)27-4)28(23,24)19-13(22)17-12-15-6(25-2)5-7(16-12)26-3/h5H,1-4H3,(H2,15,16,17,19,22) | | InChIKey | FMGZEUWROYGLAY-UHFFFAOYSA-N | | SMILES | N1(C)C(S(NC(NC2=NC(OC)=CC(OC)=N2)=O)(=O)=O)=C(C(OC)=O)C(Cl)=N1 | | CAS DataBase Reference | 100784-20-1(CAS DataBase Reference) | | EPA Substance Registry System | Halosulfuron-methyl (100784-20-1) |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 3 | | RTECS | UQ6392606 | | HS Code | 2935.90.9500 | | HazardClass | 9 | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Repr. 1B | | Toxicity | LD50 orally in rats: 8865 mg/kg; dermally in rabbits: >2000 mg/kg; LC50 (4 hr) in rats: >4.3 mg/l (Suzuki) |
| | Halosulfuron methyl Usage And Synthesis |
| Uses | Herbicide. | | Definition | ChEBI: Halosulfuron-methyl is a member of pyrazoles. | | Hazard | Moderately toxic by ingestion. |
| | Halosulfuron methyl Preparation Products And Raw materials |
|