|
|
| | N-Methyl-N-(trimethylsilyl)trifluoroacetamide Basic information |
| | N-Methyl-N-(trimethylsilyl)trifluoroacetamide Chemical Properties |
| Melting point | 98-100°C | | Boiling point | 130132°C | | density | 1.075 g/mL at 25 °C(lit.) | | vapor density | >1 (vs air) | | vapor pressure | 8.8 mm Hg ( 27 °C) | | refractive index | n20/D 1.383 | | Fp | 77 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | pka | -1.34±0.70(Predicted) | | form | Liquid | | color | Clear colorless to light yellow | | Specific Gravity | 1.076 | | Water Solubility | reacts | | Sensitive | Moisture Sensitive | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | BRN | 1941550 | | Major Application | forensics and toxicology | | InChI | 1S/C6H12F3NOSi/c1-10(12(2,3)4)5(11)6(7,8)9/h1-4H3 | | InChIKey | MSPCIZMDDUQPGJ-UHFFFAOYSA-N | | SMILES | CN(C(=O)C(F)(F)F)[Si](C)(C)C | | CAS DataBase Reference | 24589-78-4(CAS DataBase Reference) | | EPA Substance Registry System | Acetamide, 2,2,2-trifluoro-N-methyl-N-(trimethylsilyl)- (24589-78-4) |
| Hazard Codes | Xi,F,T,N | | Risk Statements | 10-36/37/38-61-50/53-51/53 | | Safety Statements | 26-36-37/39-16-45-53-61 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | RTECS | AC9800000 | | F | 10-21 | | Hazard Note | Flammable | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29319090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | N-Methyl-N-(trimethylsilyl)trifluoroacetamide Usage And Synthesis |
| Chemical Properties | Clear colorless to light yellow liquid | | Uses | A new metabolite of Famprofazone in humans. | | Uses | N-Methyl-N-(trimethylsilyl)trifluoroacetamide is used as a silylating reagent that forms volatile derivatives for GC-MS analysis. It acts as a pharmaceutical intermediate and metabolite of Famprofazone in humans. It is also used in the detection of steroid hormones 17-alfa-ethynylestradiol and estrone. | | Definition | ChEBI: An N-silyl compound that is N-methyltrifluoroacetamide in which the amide nitrogen is replaced by a trimethylsilyl group. N-methyl-N-(trimethylsilyl)trifluoroacetamide is a derivat
sation agent used in gas chromatography/mass spectrometry applications. | | General Description | N-Methyl-N-(trimethylsilyl)trifluoroacetamide (MSTFA) is a derivatizing reagent. It can be used as alternatives to diazomethane. | | reaction suitability | reagent type: derivatization reagent reaction type: Silylations | | Purification Methods | Fractionate the amide through a 40mm Vigreux column (p 11). Usually it contains ca 1% of methyl trifluoroacetamide and 1% of other impurities which can be removed by gas chromatography or fractionating using a spinning band column. [Donike J Chromatogr 42 103 1969, Donike J Chromatogr 103 91 1975, Beilstein 4 IV 4011.] |
| | N-Methyl-N-(trimethylsilyl)trifluoroacetamide Preparation Products And Raw materials |
|