- 6-ROX, SE
-
- $7.00 / 1KG
-
2019-09-02
- CAS: 216699-36-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: JD 433
|
| | 6-ROX, SE Basic information |
| Product Name: | 6-ROX, SE | | Synonyms: | 6-CXR SE;6-ROX SE, 6-CXR SE;6-ROX, SE [6-Carboxy-X-rhodaMine, suciniMidyl ester];6-CARBOXY-X-RHODAMINE N-SUCCINIMIDYL ESTER;6-CARBOXY-X-RHODAMINE, SUCCINIMIDYL ESTER;6-ROX, SE;1H,5H,11H,15H-Xantheno[2,3,4-ij:5,6,7-i'j']diquinolizin-18-ium,9-[2-carboxy-5-[[(2,5-dioxo-1-pyrrolidinyl)oxy]carbonyl]phenyl]-2,3,6,7,12,13,16,17-octahydro-,inner salt;6-Carboxy-X-rhodamine, succinimidyl ester, single isomer | | CAS: | 216699-36-4 | | MF: | C37H33N3O7 | | MW: | 631.68 | | EINECS: | | | Product Categories: | Nucleic Acid Stains For MicroscopyFluorescent Probes, Labels, Particles and Stains;Biochemicals and Reagents;DetectionFluorescent Stains;Fluorescent Labels;Fluorescent Probes, Labels, Particles and Stains;Nucleic Acid Stains;Rhodamine and Derivatives;ROX | | Mol File: | 216699-36-4.mol |  |
| | 6-ROX, SE Chemical Properties |
| storage temp. | −20°C | | solubility | DMF: soluble | | form | Solid | | color | Light brown to brown | | Appearance | Dark red solid | | ε(extinction coefficient) | 91000 L⋅mol−1⋅cm−1 | | Φ(quantum yield) | 1.0 | | ex/em | 575/603 nm | | InChIKey | KWADUASJUMATIK-UHFFFAOYSA-N | | SMILES | C(C1C=CC(C(=O)ON2C(CCC2=O)=O)=CC=1C1C2=CC3CCCN4CCCC(C=34)=C2[O+]=C2C3CCCN4CCCC(C=34)=CC=12)(=O)[O-] |
| | 6-ROX, SE Usage And Synthesis |
| Chemical Properties | Appearance: Deep red solid
ex/em: 575/603 nm
Extinction coefficient (ε): 91000 Lmol1cm1
Quantum yield (Φ): 1.0 | | Uses | 6-ROX, SE can be used as amine-Reactive Fluorescent probe for labeling oligonucleotide and for preparation of labeled primers which are used in real-time PCR. | | Uses | Amine-Reactive Fluorescent probe for labeling oligonucleotide. | | Uses | 6-Carboxy-X-rhodamine N-succinimidyl ester is a rhodamine X derivative. |
| | 6-ROX, SE Preparation Products And Raw materials |
|