4-Phenyl-1,2,3,6-tetrahydropyridine hydrochloride manufacturers
|
| | 4-Phenyl-1,2,3,6-tetrahydropyridine hydrochloride Basic information |
| Product Name: | 4-Phenyl-1,2,3,6-tetrahydropyridine hydrochloride | | Synonyms: | 1,2,3,6-TETRAHYDRO-4-PHENYLPYRIDINE HYDROCHLORIDE;4-PHENYL-1,2,3,6-TETRAHYDROPYRIDINE HCL;4-PHENYL-1,2,3,6-TETRAHYDROPYRIDINE HYDROCHLORIDE;4-(1-cyclohex-3-enyl)pyridine hydrochloride;TIMTEC-BB SBB003589;4-Phenyl-1,2,3,6-tetrahydropyridine NCl;4-PHENYL-1,2,3,6-TETRAHYDROPYRIDINE HYDR OCHLORIDE, TECH.;4-Phenyl-1,2,3,6-tetrahydroxpyridine | | CAS: | 43064-12-6 | | MF: | C11H14ClN | | MW: | 195.69 | | EINECS: | 256-071-5 | | Product Categories: | C9 to C46;Heterocyclic Building Blocks;Pyridines;Heterocyclic Compounds;Pyridines, Pyrimidines, Purines and Pteredines;Building Blocks;C11;Chemical Synthesis;Heterocyclic Building Blocks | | Mol File: | 43064-12-6.mol |  |
| | 4-Phenyl-1,2,3,6-tetrahydropyridine hydrochloride Chemical Properties |
| Melting point | 202-203.5 °C(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Water Solubility | Soluble | | Stability: | Hygroscopic | | InChI | 1S/C11H13N.ClH/c1-2-4-10(5-3-1)11-6-8-12-9-7-11;/h1-6,12H,7-9H2;1H | | InChIKey | POGWXTJNUCZEPR-UHFFFAOYSA-N | | SMILES | Cl[H].C1CC(=CCN1)c2ccccc2 | | CAS DataBase Reference | 43064-12-6(CAS DataBase Reference) |
| Hazard Codes | T,Xn | | Risk Statements | 23/24/25-40-20/21/22 | | Safety Statements | 28-36/37/39-38-45-28A-36 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29333990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Carc. 2 |
| | 4-Phenyl-1,2,3,6-tetrahydropyridine hydrochloride Usage And Synthesis |
| Chemical Properties | light brown powder | | Uses | 4-Phenyl-1,2,3,6-tetrahydropyridine fragment containing benzamide derivatives have been prepared. Presence of the 4-phenyl-1,2,3,6-tetrahydropyridine fragment improves the inhibitory potential of benzamide analogs against poly(ADP-ribose) polymerase-1 (PARP-1). | | General Description | 4-Phenyl-1,2,3,6-tetrahydropyridine fragment containing benzamide derivatives have been prepared. Presence of the 4-phenyl-1,2,3,6-tetrahydropyridine fragment improves the inhibitory potential of benzamide analogs against poly(ADP-ribose) polymerase-1 (PARP-1). |
| | 4-Phenyl-1,2,3,6-tetrahydropyridine hydrochloride Preparation Products And Raw materials |
|