|
|
| | 2,2,3,3-Tetrafluoropropyl methacrylate Basic information |
| Product Name: | 2,2,3,3-Tetrafluoropropyl methacrylate | | Synonyms: | METHACRYLIC ACID 2,2,3,3-TETRAFLUOROPROPYL ESTER;1H,1H,3H-TETRAFLUOROPROPYL METHACRYLATE;2,2,3,3-TETRAFLUOROPROPYL 2-METHYLPROPENOATE;2,2,3,3-TETRAFLUOROPROPYL METHACRYLATE;2,2,3,3-Tetrafluoropropyl 2-methylacrylate;2-Propenoic acid, 2-methyl-, 2,2,3,3-tetrafluoropropyl ester;2,2,3,3-Tetrafluorop;[stabilized with 2,2 -Methylenebis(6-tert-butyl-4-Methylphenol)] | | CAS: | 45102-52-1 | | MF: | C7H8F4O2 | | MW: | 200.13 | | EINECS: | 256-189-7 | | Product Categories: | Fluorinated AcrylicsPhotonic and Optical Materials;Acrylic Monomers;C6 to C7Monomers;Carbonyl Compounds;Esters;Low Refractive Index Monomers;Waveguide Materials;monomer | | Mol File: | 45102-52-1.mol |  |
| | 2,2,3,3-Tetrafluoropropyl methacrylate Chemical Properties |
| Melting point | <0°C | | Boiling point | 124 °C (lit.) | | density | 1.25 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.373(lit.) | | Fp | 123 °F | | storage temp. | Keep in dark place,Sealed in dry,2-8°C | | form | liquid | | Specific Gravity | 1.254 | | color | Clear Colourless | | BRN | 3588831 | | InChI | InChI=1S/C7H8F4O2/c1-4(2)5(12)13-3-7(10,11)6(8)9/h6H,1,3H2,2H3 | | InChIKey | RSVZYSKAPMBSMY-UHFFFAOYSA-N | | SMILES | C(OCC(F)(F)C(F)F)(=O)C(C)=C | | CAS DataBase Reference | 45102-52-1(CAS DataBase Reference) | | NIST Chemistry Reference | 2,2,3,3-Tetrafluoropropyl methacrylate(45102-52-1) | | EPA Substance Registry System | 2,2,3,3-Tetrafluoropropyl methacrylate (45102-52-1) |
| Hazard Codes | Xn,F | | Risk Statements | 10-22-37/38-41 | | Safety Statements | 16-26-39 | | RIDADR | UN 3272 3/PG 3 | | WGK Germany | - | | Hazard Note | Flammable/Keep Cold | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29161290 |
| | 2,2,3,3-Tetrafluoropropyl methacrylate Usage And Synthesis |
| Chemical Properties | clear colorless liquid |
| | 2,2,3,3-Tetrafluoropropyl methacrylate Preparation Products And Raw materials |
|