|
|
| | Methyl 5-chloropentanoate Basic information |
| Product Name: | Methyl 5-chloropentanoate | | Synonyms: | METHYL 5-CHLOROPENTANOATE;METHYL 5-CHLOROVALERATE;5-Chloropentanoic acid, methyl ester;ClCH2(CH2)3C(O)OCH3;Methyl delta-chlorovalerate;Pentanoic acid, 5-chloro-, methyl ester;Valeric acid, 5-chloro-, methyl ester;METHYL5-CHLOROPENTANOATE,97% | | CAS: | 14273-86-0 | | MF: | C6H11ClO2 | | MW: | 150.6 | | EINECS: | | | Product Categories: | C6 to C7;Carbonyl Compounds;Esters | | Mol File: | 14273-86-0.mol |  |
| | Methyl 5-chloropentanoate Chemical Properties |
| Boiling point | 106-107 °C/38 mmHg (lit.) | | density | 1.047 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.436(lit.) | | Fp | 194 °F | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Oil | | color | Colourless | | InChI | InChI=1S/C6H11ClO2/c1-9-6(8)4-2-3-5-7/h2-5H2,1H3 | | InChIKey | JAVHFVJOWIQHII-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CCCCCl | | CAS DataBase Reference | 14273-86-0(CAS DataBase Reference) | | NIST Chemistry Reference | Methyl «delta»-chlorovalerate(14273-86-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-27-28-36/37/39-24/25 | | WGK Germany | 3 | | HS Code | 2915907098 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Methyl 5-chloropentanoate Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | Methyl 5-chlorovalerate undergoes gas phase elimination over the temperature range of 419.6–472.1°C and pressure range of 45–108 torr via intimate ion pair type mechanism. | | General Description | Methyl 5-chlorovalerate undergoes gas phase elimination over the temperature range of 419.6–472.1°C and pressure range of 45–108 torr via intimate ion pair type mechanism. |
| | Methyl 5-chloropentanoate Preparation Products And Raw materials |
|