- 5-Hexenoic acid
-
- $786.00 / 1Kg
-
2024-11-13
- CAS:1577-22-6
- Min. Order: 1Kg
- Purity: 97
- Supply Ability: 500 Kg
- 5-HEXENOIC ACID
-
- $0.00 / 25KG
-
2024-03-28
- CAS:1577-22-6
- Min. Order: 25KG
- Purity: ≥95%
- Supply Ability: Inquiry
- 5-HEXENOIC ACID
-
- $15.00 / 1KG
-
2021-08-12
- CAS:1577-22-6
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 5-HEXENOIC ACID Basic information |
| | 5-HEXENOIC ACID Chemical Properties |
| Melting point | -37°C | | Boiling point | 105 °C/15 mmHg (lit.) | | density | 0.961 g/mL at 25 °C (lit.) | | refractive index | 1.4340 | | Fp | 107°C/17mm | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.76±0.10(Predicted) | | form | clear liquid | | color | Colorless to Light yellow | | Specific Gravity | 0.961 | | Water Solubility | Insoluble in water. | | BRN | 1743172 | | InChI | InChI=1S/C6H10O2/c1-2-3-4-5-6(7)8/h2H,1,3-5H2,(H,7,8) | | InChIKey | XUDOZULIAWNMIU-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCC=C | | LogP | 1.256 (est) | | CAS DataBase Reference | 1577-22-6(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-27 | | RIDADR | 3265 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29161900 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| Provider | Language |
|
ALFA
| English |
| | 5-HEXENOIC ACID Usage And Synthesis |
| Uses | 5-Hexenoic acid is used as an organic chemical synthesis intermediate. | | Uses | 5-Hexenoic acid may be used for the preparation of iodolactone derivatives and fluorine-containing δ-valerolactones. | | Definition | ChEBI: Delta-hexenoic acid is a medium-chain fatty acid. | | Synthesis Reference(s) | Journal of the American Chemical Society, 112, p. 6729, 1990 DOI: 10.1021/ja00174a053 |
| | 5-HEXENOIC ACID Preparation Products And Raw materials |
|