| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Fluoro-2-(trifluoromethyl)benzoic acid Basic information |
| Product Name: | 4-Fluoro-2-(trifluoromethyl)benzoic acid | | Synonyms: | RARECHEM AL BO 0635;TIMTEC-BB SBB006651;à,à,à,4-tetrafluoro-o-toluic acid;4-Fluoro-2-(trifluoromethyl)benzoic acid 98%;4-Fluoro-2-(trifluoromethyl)benzoicacid98%;ALPHA,ALPHA,ALPHA,4-TETRAFLUORO-O-TOLUIC ACID;α,α.α,4-Tetrafluoro-o-toluic Acid;4-Fluoro-2-(trifluoroMethyl)benzoic acid, 97+% | | CAS: | 141179-72-8 | | MF: | C8H4F4O2 | | MW: | 208.11 | | EINECS: | 256-495-9 | | Product Categories: | Fluorine series;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Benzoic acid;C8;Carbonyl Compounds;Carboxylic Acids;Fluorobenzene | | Mol File: | 141179-72-8.mol |  |
| | 4-Fluoro-2-(trifluoromethyl)benzoic acid Chemical Properties |
| Melting point | 121-124 °C (lit.) | | Boiling point | 239.0±40.0 °C(Predicted) | | density | 1.4412 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | 3.17±0.36(Predicted) | | form | Needle-Like Crystalline Powder | | color | Slightly yellow | | InChI | InChI=1S/C8H4F4O2/c9-4-1-2-5(7(13)14)6(3-4)8(10,11)12/h1-3H,(H,13,14) | | InChIKey | JUHPDXOIGLHXTC-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(F)C=C1C(F)(F)F | | CAS DataBase Reference | 141179-72-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Fluoro-2-(trifluoromethyl)benzoic acid Usage And Synthesis |
| Chemical Properties | slightly yellow needle-like crystalline powder | | Uses | 4-Fluoro-2-(trifluoromethyl)benzoic acid is a substituted benzoic acid derivative. Molecular orbital and empirical methods have been utilized to determine its computed steric and electronic properties. | | General Description | 4-Fluoro-2-(trifluoromethyl)benzoic acid is a substituted benzoic acid derivative. Molecular orbital and empirical methods have been utilized to determine its computed steric and electronic properties. | | Synthesis | Magnesium powder and a small pellet of iodine were added to the reaction flask, which was dried at high temperature, and the reaction system was then nitrogen-protected (air in the reaction system was replaced with nitrogen) through a double-row tube. Anhydrous tetrahydrofuran and 2-bromo-5-fluorobenzotrifluoride were then added to the reaction system under nitrogen atmosphere and the resulting mixture system was heated to reflux in an oil bath and the reaction was stirred at reflux for 2 hours to prepare the corresponding format reagents. The reaction system was cooled to room temperature and then the nitrogen in the reaction system was replaced with the corresponding carbon dioxide and the resulting reaction mixture was stirred and reacted at room temperature overnight. After the reaction, hydrochloric acid was added to the reaction system to acidify the reaction system, the reaction mixture was extracted with ethyl acetate and water, the organic layer was separated and dried, the organic layer was concentrated and the residue was purified by silica gel column chromatography to obtain the target molecule 4-fluoro-2-(trifluoromethyl)benzoic acid. |
| | 4-Fluoro-2-(trifluoromethyl)benzoic acid Preparation Products And Raw materials |
|