|
|
| | ethyl 2-(cyclopropylamino)acetate Basic information |
| Product Name: | ethyl 2-(cyclopropylamino)acetate | | Synonyms: | ethyl 2-(cyclopropylamino)acetate;2-(cyclopropylamino)acetic acid ethyl ester;ethyl 2-(cyclopropylamino)ethanoate;ethyl N-cyclopropylglycinate;methyl cyclopropylglycinate;[(cyclopropyl)amino]acetic acid ethyl ester;N-Cyclopropyl-glycine ethyl ester;Glycine, N-cyclopropyl-, ethyl ester | | CAS: | 71922-62-8 | | MF: | C7H13NO2 | | MW: | 143.18 | | EINECS: | | | Product Categories: | | | Mol File: | 71922-62-8.mol |  |
| | ethyl 2-(cyclopropylamino)acetate Chemical Properties |
| Boiling point | 197.8±23.0 °C(Predicted) | | density | 1.04±0.1 g/cm3(Predicted) | | form | oil | | pka | 6.58±0.20(Predicted) | | color | Clear | | InChI | InChI=1S/C7H13NO2/c1-2-10-7(9)5-8-6-3-4-6/h6,8H,2-5H2,1H3 | | InChIKey | VOZPZBSGYPGXEE-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CNC1CC1 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | HS Code | 2922498590 |
| | ethyl 2-(cyclopropylamino)acetate Usage And Synthesis |
| | ethyl 2-(cyclopropylamino)acetate Preparation Products And Raw materials |
|