4-HYDROXY-6-METHYL-3-NITRO-2-PYRIDONE manufacturers
|
| | 4-HYDROXY-6-METHYL-3-NITRO-2-PYRIDONE Basic information |
| | 4-HYDROXY-6-METHYL-3-NITRO-2-PYRIDONE Chemical Properties |
| Melting point | 293-296 °C(lit.) | | Boiling point | 305.6±42.0 °C(Predicted) | | density | 1.53±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Solubility in N,N-DMF gives very faint turbidity. | | form | Powder | | pka | 4.50±1.00(Predicted) | | color | Yellow | | BRN | 1529425 | | InChI | InChI=1S/C6H6N2O4/c1-3-2-4(9)5(8(11)12)6(10)7-3/h2H,1H3,(H2,7,9,10) | | InChIKey | QIKWTNPFTOEELW-UHFFFAOYSA-N | | SMILES | C1(=O)NC(C)=CC(O)=C1[N+]([O-])=O | | CAS DataBase Reference | 4966-90-9(CAS DataBase Reference) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29333999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-HYDROXY-6-METHYL-3-NITRO-2-PYRIDONE Usage And Synthesis |
| Chemical Properties | Yellow powder | | Uses | It is employed as a pharmaceutical intermediate. | | Uses | 4-Hydroxy-6-methyl-3-nitro-2-pyridone may be used as a reactant in the synthesis of pyridylthiazole derivative and 4-chloro-6-methyl-3-nitro-2-pyridone. | | General Description | 4-Hydroxy-6-methyl-3-nitro-2-pyridone is a piperidone derivative. |
| | 4-HYDROXY-6-METHYL-3-NITRO-2-PYRIDONE Preparation Products And Raw materials |
|