|
|
| | Benzofuran-2-boronic acid Basic information |
| | Benzofuran-2-boronic acid Chemical Properties |
| Melting point | 114-116 °C (lit.) | | Boiling point | 340.4±34.0 °C(Predicted) | | density | 1.31±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 6.22±0.30(Predicted) | | form | Powder | | color | Pale yellow to yellow | | Water Solubility | Soluble in water. | | BRN | 1637889 | | InChI | InChI=1S/C8H7BO3/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5,10-11H | | InChIKey | PKRRNTJIHGOMRC-UHFFFAOYSA-N | | SMILES | O1C(B(O)O)=CC2=CC=CC=C12 | | CAS DataBase Reference | 98437-24-2(CAS DataBase Reference) |
| | Benzofuran-2-boronic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | It is used in the facile preparation of highly-functionalized, nitrogen-bearing diarylmethanes. | | Uses | Benzofuran-2-boronic Acid is a reagent used in the facile preparation of highly-functionalized, nitrogen-bearing diarylmethanes. |
| | Benzofuran-2-boronic acid Preparation Products And Raw materials |
|