- BOC-MET-OSU
-
- $1.00 / 1KG
-
2024-08-12
- CAS:3845-64-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
|
| | BOC-MET-OSU Basic information |
| Product Name: | BOC-MET-OSU | | Synonyms: | N-ALPHA-T-BOC-L-METHIONINE N-HYDROXYSUCCINIMIDE ESTER;BOC-L-METHIONINE HYDROXYSUCCINIMIDE ESTER;BOC-L-METHIONINE N-HYDROXYSUCCINIMIDE ESTER;BOC-METHIONINE-OSU;BOC-MET-OSU;n-hydroxysuccinimidylt-butoxycarbonylmethionine;succinimido (S)-2-[(tert-butoxycarbonyl)amino]-4-(methylthio)butyrate;Boc-L-methionine hydeoxysuccinimide ester | | CAS: | 3845-64-5 | | MF: | C14H22N2O6S | | MW: | 346.4 | | EINECS: | 223-341-9 | | Product Categories: | Amino Acids;Amino Acid Derivatives | | Mol File: | 3845-64-5.mol |  |
| | BOC-MET-OSU Chemical Properties |
| Melting point | 120-126 °C | | storage temp. | -20°C | | form | Solid | | color | White to Almost white | | Optical Rotation | [α]20/D 21.5±2°, c = 2% in dioxane | | Sensitive | Moisture Sensitive | | BRN | 4238574 | | Major Application | peptide synthesis | | InChI | 1S/C14H22N2O6S/c1-14(2,3)21-13(20)15-9(7-8-23-4)12(19)22-16-10(17)5-6-11(16)18/h9H,5-8H2,1-4H3,(H,15,20)/t9-/m0/s1 | | InChIKey | PCZJWSPKNYONIM-VIFPVBQESA-N | | SMILES | CSCC[C@H](NC(=O)OC(C)(C)C)C(=O)ON1C(=O)CCC1=O | | CAS DataBase Reference | 3845-64-5 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | F | 3-10-21 | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids |
| | BOC-MET-OSU Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-MET-OSU Preparation Products And Raw materials |
|