- Tripropylsilane
-
- $1.10 / 100kg
-
2025-10-13
- CAS:998-29-8
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 100kg
- TRI-N-PROPYLSILANE
-
- $2.00 / 1KG
-
2019-07-06
- CAS:998-29-8
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: customise
|
| | Tri-N-Propylsilane Basic information |
| | Tri-N-Propylsilane Chemical Properties |
| Boiling point | 171 °C(lit.) | | density | 0.758 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.426(lit.) | | Fp | 110 °F | | storage temp. | Flammables area | | Specific Gravity | 0.758 | | Hydrolytic Sensitivity | 3: reacts with aqueous base | | BRN | 1733500 | | InChI | InChI=1S/C9H22Si/c1-4-7-10(8-5-2)9-6-3/h10H,4-9H2,1-3H3 | | InChIKey | ZHOVAWFVVBWEGQ-UHFFFAOYSA-N | | SMILES | [SiH](CCC)(CCC)CCC | | CAS DataBase Reference | 998-29-8 | | EPA Substance Registry System | Silane, tripropyl- (998-29-8) |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 1 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29310099 |
| | Tri-N-Propylsilane Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Application | Reactivity similar to that of triethylsilane. |
| | Tri-N-Propylsilane Preparation Products And Raw materials |
|