BOC-(R)-3-AMINO-5-PHENYLPENTANOIC ACID manufacturers
|
| | BOC-(R)-3-AMINO-5-PHENYLPENTANOIC ACID Basic information |
| | BOC-(R)-3-AMINO-5-PHENYLPENTANOIC ACID Chemical Properties |
| storage temp. | 2-8°C | | form | powder | | Optical Rotation | [α]/D +1.5±0.5°, c = 1 in ethanol | | Major Application | peptide synthesis | | InChI | 1S/C16H23NO4/c1-16(2,3)21-15(20)17-13(11-14(18)19)10-9-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3,(H,17,20)(H,18,19)/t13-/m1/s1 | | InChIKey | MYWZFJXOLAXENE-CYBMUJFWSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](CCc1ccccc1)CC(O)=O | | CAS DataBase Reference | 218608-83-4(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | BOC-(R)-3-AMINO-5-PHENYLPENTANOIC ACID Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-(R)-3-AMINO-5-PHENYLPENTANOIC ACID Preparation Products And Raw materials |
|