|
|
| | cis-Chlorfenvinphos Basic information |
| Product Name: | cis-Chlorfenvinphos | | Synonyms: | SUPONA;SUPONA(R);STELADONE(R);SAPECRON(R);TRANS-CHLORFENVINPHOS;CIS-CHLORFENVINPHOS;CHLORFENVINPHOS;BIRLANE | | CAS: | 18708-87-7 | | MF: | C12H14Cl3O4P | | MW: | 359.57 | | EINECS: | | | Product Categories: | | | Mol File: | 18708-87-7.mol |  |
| | cis-Chlorfenvinphos Chemical Properties |
| Melting point | -21 °C | | Boiling point | 396.5±42.0 °C(Predicted) | | density | 1.373±0.06 g/cm3(Predicted) | | solubility | Dichloromethane (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Stability: | Moisture Sensitive | | NIST Chemistry Reference | Cis-chlorfenvinphos(18708-87-7) |
| | cis-Chlorfenvinphos Usage And Synthesis |
| Uses | (Z)-Chlorfenvinphos is an stereoisomer of Chlorfenvinphos (C324360), and is an insecticidal agent. Pesticide. |
| | cis-Chlorfenvinphos Preparation Products And Raw materials |
|