|
|
| | 5-Thiazolamine, 2-methyl- Basic information |
| | 5-Thiazolamine, 2-methyl- Chemical Properties |
| Boiling point | 229.1±13.0 °C(Predicted) | | density | 1.258±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 4.72±0.10(Predicted) | | Appearance | Light yellow to brown Solid | | InChI | InChI=1S/C4H6N2S/c1-3-6-2-4(5)7-3/h2H,5H2,1H3 | | InChIKey | IDSUZAVUCMIBBS-UHFFFAOYSA-N | | SMILES | S1C(N)=CN=C1C |
| | 5-Thiazolamine, 2-methyl- Usage And Synthesis |
| Synthesis | 1. Acetaldehyde reacts with a cyanosilane in methanolic ammonia to give intermediate a1 (likely an aminonitrile).
2. Ethyl chloroacetate reacts with sulfur and triethylamine, then with bromoethane to yield intermediate b1 (likely a thioester).
3. b1 condenses with a1 to cyclize, forming thiazole intermediate c1.
4. c1 undergoes hydrolysis, acidification, cyclization, basification, and extraction to yield 2-methyl-5-aminothiazole. |
| | 5-Thiazolamine, 2-methyl- Preparation Products And Raw materials |
|