| Company Name: |
Beijing HwrkChemical Technology Co., Ltd
|
| Tel: |
89508211 18501085097 |
| Email: |
sales.bj@hwrkchemical.com |
| Products Intro: |
Product Name:bis(trideuteriomethyl) carbonate
CAS:108481-44-3
Purity:98% Package:1g/5g/100g Remarks:HWRK170014
|
DIMETHYL CARBONATE-D6 manufacturers
- Dimethyl-d6 Carbonate
-
- $1.00 / 1KG
-
2025-12-12
- CAS:108481-44-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000KG
|
| | DIMETHYL CARBONATE-D6 Basic information |
| Product Name: | DIMETHYL CARBONATE-D6 | | Synonyms: | DiMethylcarbona;DIMETHYL CARBONATE-D6;DIMETHYL-D6 CARBONATE;DIMETHYL CARBONATE-D6 (D, 99%);[2H6]dimethyl carbonate;Dimethylcarbonate-d6 (Reagent Grade);bis(trideuteriomethyl) carbonate;Dimethyl-d6 carbonate | | CAS: | 108481-44-3 | | MF: | C3D6O3 | | MW: | 96.11 | | EINECS: | 690-550-3 | | Product Categories: | | | Mol File: | 108481-44-3.mol |  |
| | DIMETHYL CARBONATE-D6 Chemical Properties |
| Melting point | 2-4°C | | Boiling point | 90°C | | Fp | 16℃ | | form | liquid | | Major Application | pharmaceutical | | InChI | InChI=1S/C3H6O3/c1-5-3(4)6-2/h1-2H3/i1D3,2D3 | | InChIKey | IEJIGPNLZYLLBP-WFGJKAKNSA-N | | SMILES | C([2H])([2H])([2H])OC(=O)OC([2H])([2H])[2H] | | CAS Number Unlabeled | 616-38-6 |
| Hazard Codes | F | | Risk Statements | 11 | | Safety Statements | 9-16-2017/9/16 | | RIDADR | 1161 | | WGK Germany | WGK 1 | | HS Code | 28459000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2 |
| | DIMETHYL CARBONATE-D6 Usage And Synthesis |
| Uses | Dimethyl-d6 Carbonate is the labeled analogue of Dimethyl Carbonate (D446705), which is used in the synthesis of phosphine-boranes in the preparation of new bidentate ligands. Also used in the synthesis of flavonoid analogs. |
| | DIMETHYL CARBONATE-D6 Preparation Products And Raw materials |
|