|
|
| | 3,3',4,4'-Biphenyltetracarboxylic acid Basic information |
| Product Name: | 3,3',4,4'-Biphenyltetracarboxylic acid | | Synonyms: | [1,1'-BIPHENYL]-3,3',4,4'-TETRACARBOXYLIC ACID;Biphenyl-3,3',4,4'-tetracarboxylicacid;3,3',4,4'-[1,1'-Biphenyl]tetracarboxylic acid;3,4,3',4'-Biphenyltetracarboxylic acid;5,5'-Bi[phthalic acid];3,3',4,4'-Biphenylte;3,34,4-BIPHENYL TETRACARBOXYLIC ACID,99% MIN;4-(3,4-dicarboxyphenyl)phthalic Acid | | CAS: | 22803-05-0 | | MF: | C16H10O8 | | MW: | 330.25 | | EINECS: | 2017-001-1 | | Product Categories: | Organic acids | | Mol File: | 22803-05-0.mol |  |
| | 3,3',4,4'-Biphenyltetracarboxylic acid Chemical Properties |
| Melting point | >300 C | | Boiling point | 673.3±55.0 °C(Predicted) | | density | 1.612±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Powder to crystal | | pka | 2.80±0.10(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C16H10O8/c17-13(18)9-3-1-7(5-11(9)15(21)22)8-2-4-10(14(19)20)12(6-8)16(23)24/h1-6H,(H,17,18)(H,19,20)(H,21,22)(H,23,24) | | InChIKey | LFBALUPVVFCEPA-UHFFFAOYSA-N | | SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)C(=O)O)C(=O)O)C(=O)O)C(=O)O | | CAS DataBase Reference | 22803-05-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | TSCA | TSCA listed |
| | 3,3',4,4'-Biphenyltetracarboxylic acid Usage And Synthesis |
| Uses | 3,3',4,4'-Biphenyltetracarboxylic acid is converted to 3,3',4,4'-biphenyl dianhydride after dehydration, and the latter can be polymerised with a variety of diamines to obtain polyimide insulating materials with excellent heat resistance, hydrolysis resistance, and good mechanical and flexibility properties. This material has been widely used in aerospace, microelectronics and atomic energy and other high-tech fields. |
| | 3,3',4,4'-Biphenyltetracarboxylic acid Preparation Products And Raw materials |
|