- 4-BIPHENYLSULFONYL CHLORIDE
-
- $15.00 / 1KG
-
2021-08-12
- CAS:1623-93-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 4-BIPHENYLSULFONYL CHLORIDE Basic information |
| | 4-BIPHENYLSULFONYL CHLORIDE Chemical Properties |
| Melting point | 103-108 °C(lit.) | | Boiling point | 200-205°C 6mm | | density | 1.320±0.06 g/cm3(Predicted) | | Fp | 200-205°C/6mm | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO: 50 mg/mL (197.85 mM);; | | form | Crystalline Powder | | color | White | | Water Solubility | Reacts with water. | | Sensitive | Moisture Sensitive | | BRN | 2694373 | | InChI | InChI=1S/C12H9ClO2S/c13-16(14,15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H | | InChIKey | ALBQXDHCMLLQMB-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=CC=C(S(Cl)(=O)=O)C=C1 | | CAS DataBase Reference | 1623-93-4(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 14-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 4-BIPHENYLSULFONYL CHLORIDE Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | Reactant for:• ;Preparation of anilinopyrimidinesulfonamides as potential anticancer agents1• ;Synthesis of inhibitors of the hypoxia inducible factor pathway2• ;Preparation of hydroxy-sulfonyl-piperidinyl butyramides as HDAC inhibitors and potential antitumors3• ;Palladium-catalyzed desulfitative C-arylation4 | | Uses | It is a reactant for preparation of anilinopyrimidinesulfonamides as potential anticancer agents, synthesis of inhibitors of the hypoxia inducible factor pathway. It participates in the preparation of hydroxy-sulfonyl-piperidinyl butyramides as HDAC inhibitors and potential antitumors and is also involved in palladium-catalyzed desulfitative C-arylation. |
| | 4-BIPHENYLSULFONYL CHLORIDE Preparation Products And Raw materials |
|