1,3-DIHYDROXYANTHRAQUINONE manufacturers
- Xanthopurpurin
-
- $105.00
-
2026-04-22
- CAS:518-83-2
- Purity: 98.05%
- Supply Ability: 10g
|
| | 1,3-DIHYDROXYANTHRAQUINONE Basic information |
| Product Name: | 1,3-DIHYDROXYANTHRAQUINONE | | Synonyms: | 1,3-DIHYDROXYANTHRAQUINONE;1,3-Dihydroxy-9,10-anthracenedione;2,4-Dihydroxy-9,10-anthracenedione;1,3-dihydroxy-9,10-anthraquinone;9,10-Anthracenedione, 1,3-dihydroxy-;anthropomorphous;Xanthopurpurin,Inhibitor,inhibit,Purpuroxanthin;1,3-dihydroxyanthracene-9,10-dione | | CAS: | 518-83-2 | | MF: | C14H8O4 | | MW: | 240.21 | | EINECS: | | | Product Categories: | | | Mol File: | 518-83-2.mol |  |
| | 1,3-DIHYDROXYANTHRAQUINONE Chemical Properties |
| Melting point | 266-268℃ | | form | Solid | | color | White to yellow | | InChI | InChI=1S/C14H8O4/c15-7-5-10-12(11(16)6-7)14(18)9-4-2-1-3-8(9)13(10)17/h1-6,15-16H | | InChIKey | WPWWKBNOXTZDQJ-UHFFFAOYSA-N | | SMILES | C1(O)=C2C(C(=O)C3=C(C2=O)C=CC=C3)=CC(O)=C1 | | EPA Substance Registry System | 9,10-Anthracenedione, 1,3-dihydroxy- (518-83-2) |
| | 1,3-DIHYDROXYANTHRAQUINONE Usage And Synthesis |
| Uses | Xanthopurpurin, an anthraquinone glycoside, isolated from the roots of Rubia akane, shows mainly strong inhibition of collagen-induced platelet aggregation[1]. | | Definition | ChEBI: Xanthopurpurin is a dihydroxyanthraquinone. It has a role as a metabolite. | | References | [1] M I Chung, et al. Antiplatelet constituents of formosan Rubia akane. J Nat Prod. 1994 Feb;57(2):313-6. DOI:10.1021/np50104a020 |
| | 1,3-DIHYDROXYANTHRAQUINONE Preparation Products And Raw materials |
|