- Luffariellolide
-
- $673.00 / 1mg
-
2026-05-11
- CAS:111149-87-2
- Min. Order:
- Purity: 98.00%
- Supply Ability: 10g
|
| | LUFFARIELLOLIDE Basic information |
| Product Name: | LUFFARIELLOLIDE | | Synonyms: | LUFFARIELLOLIDE;4-[(3E,7E)-4,8-Dimethyl-10-(2,6,6-trimethyl-1-cyclohexen-1-yl)-3,7-decadienyl]-5-hydroxy-2(5H)-furanone;4-[(3E,7E)-4,8-Dimethyl-10-(2,6,6-trimethyl-1-cyclohexenyl)-3,7-decadienyl]-5-hydroxyfuran-2(5H)-one;3-[(3E,7E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-3,7-dienyl]-2-hydroxy-2H-furan-5-one;2(5H)-Furanone, 4-[(3E,7E)-4,8-dimethyl-10-(2,6,6-trimethyl-1-cyclohexen-1-yl)-3,7-decadien-1-yl]-5-hydroxy-;Luffariellolide, phospholipase A2 (PLA2) inhibitor. Agonist at RARalpha | | CAS: | 111149-87-2 | | MF: | C25H38O3 | | MW: | 386.57 | | EINECS: | | | Product Categories: | | | Mol File: | 111149-87-2.mol |  |
| | LUFFARIELLOLIDE Chemical Properties |
| Boiling point | 541.7±50.0 °C(Predicted) | | density | 1.006±0.06 g/cm3(Predicted) | | solubility | DMSO: soluble; Ethanol: soluble | | pka | 9.98±0.40(Predicted) | | form | Pale yellow oil. | | InChI | InChI=1S/C25H38O3/c1-18(11-7-13-21-17-23(26)28-24(21)27)9-6-10-19(2)14-15-22-20(3)12-8-16-25(22,4)5/h10-11,17,24,27H,6-9,12-16H2,1-5H3/b18-11+,19-10+ | | InChIKey | JPWPYTMXSXYUPG-QZPYEDBESA-N | | SMILES | O1C(O)C(CC/C=C(\C)/CC/C=C(\C)/CCC2C(C)(C)CCCC=2C)=CC1=O |
| | LUFFARIELLOLIDE Usage And Synthesis |
| Uses | Luffariellolide is a natural sesterterpenoid which reversibly inhibits secretory phospholipase A2 isoforms from bee venom (IC50 = 230 nM) and snake venom, reducing inflammation. It blocks the production of platelet-activating factor in stimulated neutrophils (IC50 = 5 μM). Luffariellolide is also a structural mimic of all-trans retinoic acid (RA) and, at 1 μM, acts as an agonist for the RA receptors RAR α, β, and γ but not for other nuclear receptors. In RA-sensitive cancer cell lines, luffariellolide induces the expression of RAR target genes and inhibits cell growth. It also inhibits the activation of hypoxia-inducible factor by hypoxia (IC50 = 3.6 μM).[Cayman Chemical] | | Uses | Luffariellolide is an anti-inflammatory PLA2inhibitor. | | Definition | ChEBI: Luffariellolide is a diterpene lactone. |
| | LUFFARIELLOLIDE Preparation Products And Raw materials |
|