|
|
| | Methyl 2-amino-3,5-dibromobenzoate Basic information |
| Product Name: | Methyl 2-amino-3,5-dibromobenzoate | | Synonyms: | METHYL 3,5-DIBROMOANTHRANILATE;METHYL 2-AMINO-3,5-DIBROMOBENZOATE;3,5-DIBROMOANTHRANILIC ACID METHYL ESTER;2-Amino-3,5-dibromobenzoic acid methyl ester~Methyl 3,5-dibromoanthranilate;Mehtyl 3,5-Dibromoanthranilate;2-AMINO-3,5-DIBROMOBENZOIC ACID METHYL ESTER;methyl 2-azanyl-3,5-dibromo-benzoate;5-dibroMobenzoate | | CAS: | 606-00-8 | | MF: | C8H7Br2NO2 | | MW: | 308.95 | | EINECS: | 400-990-8 | | Product Categories: | Organic acids;Acids & Esters;Anilines, Amides & Amines;Bromine Compounds;bc0001 | | Mol File: | 606-00-8.mol |  |
| | Methyl 2-amino-3,5-dibromobenzoate Chemical Properties |
| Melting point | 89-91 °C(lit.) | | Boiling point | 317.9±37.0 °C(Predicted) | | density | 1.907±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | -0.30±0.10(Predicted) | | Appearance | White to off-white Solid | | BRN | 3257505 | | InChI | InChI=1S/C8H7Br2NO2/c1-13-8(12)5-2-4(9)3-6(10)7(5)11/h2-3H,11H2,1H3 | | InChIKey | NGXVMFCGYYHEGC-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(Br)=CC(Br)=C1N | | CAS DataBase Reference | 606-00-8(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 2-amino-3,5-dibromo-, methyl ester (606-00-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29224999 |
| | Methyl 2-amino-3,5-dibromobenzoate Usage And Synthesis |
| Chemical Properties | Solid crystals. 98% of industrial products have a melting point of 89-91 °C. | | Uses | Methyl 2-amino-3,5-dibromobenzoate can be used in the synthesis of drug hexyl bromide. | | Synthesis | Methyl 2-amino-3,5-dibromobenzoate can be obtained by bromination of methyl o-urethane. | | References | [1] Patent: US5089653, 1992, A
[2] Tetrahedron Letters, 2002, vol. 43, # 6, p. 1117 - 1121
[3] Mitt. Lebensmittelunters. Hyg., 1939, vol. 30, p. 246,250
[4] Journal of the Association of Official Agricultural Chemists, 1942, vol. 25, p. 537,545
[5] Pharmaceutica Acta Helvetiae, 1937, vol. 12, p. 8 |
| | Methyl 2-amino-3,5-dibromobenzoate Preparation Products And Raw materials |
|