|
|
| | D(+)-GLUCOSE MONOHYDRATE Basic information |
| Product Name: | D(+)-GLUCOSE MONOHYDRATE | | Synonyms: | ALPHA-D-GLUCOSE, MONOHYDRATE;.alpha.-D-Glucopyranose,monohydrate;a-D-Glucoxe;BLOOD SUGAR;GRAPE SUGAR;GLUCOSE, MONOHYDRATE;(GLUCOSUM) MONOHYDRICUM;D(+)-DEXTROSE MONOHYDRATE | | CAS: | 14431-43-7 | | MF: | C6H12O6.H2O | | MW: | 198.17 | | EINECS: | 604-408-5 | | Product Categories: | | | Mol File: | 14431-43-7.mol |  |
| | D(+)-GLUCOSE MONOHYDRATE Chemical Properties |
| Melting point | 83°C | | bulk density | 630kg/m3 | | storage temp. | Store at +15°C to +25°C. | | solubility | H2O: 1 M, clear, colorless | | form | White powder | | color | White to off-white | | PH | 6-7 (100g/l, H2O, 20℃) | | Optical Rotation | [α]20/D +52.5 to +53.3°, c = 10% in H2O (calc. on anhydrous subst.) | | biological source | corn | | Water Solubility | Soluble in water. | | BRN | 5250278 | | InChI | InChI=1/C6H12O6.H2O/c7-1-2-3(8)4(9)5(10)6(11)12-2;/h2-11H,1H2;1H2/t2-,3-,4+,5-,6+;/s3 | | InChIKey | SPFMQWBKVUQXJV-BTVCFUMJSA-N | | SMILES | C([C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O)O.O |&1:1,3,5,7,9,r| | | LogP | -1.880 (est) | | CAS DataBase Reference | 14431-43-7(CAS DataBase Reference) |
| WGK Germany | 3 | | F | 3 | | Autoignition Temperature | 500 °C | | TSCA | Yes | | HS Code | 17023000 | | Storage Class | 11 - Combustible Solids | | Toxicity | LD50 orally in Rabbit: 25800 mg/kg |
| | D(+)-GLUCOSE MONOHYDRATE Usage And Synthesis |
| Uses | D-(+)-Glucose monohydrate is used by industry professionals to indicate the degree to which a substance contains water, and in food industry, pharmaceuticals. | | Uses | D-(+)-Glucose monohydrate has been used as a test compound for studying its dehydration kinetics by using THz time-domain spectroscopy (THz-TDS). | | General Description | D-(+)-Glucose monohydrate is a common natural sugar, and is involved in processes like glycosylation, energy production and formation of glycans that are involved in providing structure to the cells. D-(+)-Glucose monohydrate also causes glycation which is a detrimental process in cells. It is used as a supplement for numerous cellular processes and in cell culture. | | Biochem/physiol Actions | Dextrose or glucose is an essential metabolite for brain and muscle cells. It is involved in majority of pathways and the levels are fined tuned by insulin hormone. Dextrose is majorly used in cell culture and high levels are detrimental, attenuating mesenchymal stem cell proliferation. |
| | D(+)-GLUCOSE MONOHYDRATE Preparation Products And Raw materials |
|