|
|
| | 2-Methyl-3-nitrobenzyl chloride Basic information |
| | 2-Methyl-3-nitrobenzyl chloride Chemical Properties |
| Melting point | 43-46 °C (lit.) | | Boiling point | 299.7±25.0 °C(Predicted) | | density | 1.2797 (rough estimate) | | refractive index | 1.5560 (estimate) | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Toluene | | form | powder to crystal | | color | Light yellow to Brown | | InChI | InChI=1S/C8H8ClNO2/c1-6-7(5-9)3-2-4-8(6)10(11)12/h2-4H,5H2,1H3 | | InChIKey | XZNDXQGZPOZITR-UHFFFAOYSA-N | | SMILES | C1(CCl)=CC=CC([N+]([O-])=O)=C1C | | CAS DataBase Reference | 60468-54-4(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34-36/37 | | Safety Statements | 26-27-28-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29049095 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
| | 2-Methyl-3-nitrobenzyl chloride Usage And Synthesis |
| Chemical Properties | yellow-brown chunks | | Uses | 2-Methyl-3-nitrobenzyl chloride is a lachrymatory agent. | | General Description | 2-Methyl-3-nitrobenzyl chloride is a lachrymatory agent. |
| | 2-Methyl-3-nitrobenzyl chloride Preparation Products And Raw materials |
|