| Company Name: |
Struchem Co., Ltd. Gold |
| Tel: |
0512-63009836 18994340901 |
| Email: |
helen@struchem.com |
|
| | 2-Oxazolecarboxylic acid Basic information |
| | 2-Oxazolecarboxylic acid Chemical Properties |
| Melting point | 254-256 °C (decomp)(Solv: hexane (110-54-3); dichloromethane (75-09-2)) | | Boiling point | 282 ºC | | density | 1.449 | | Fp | 125 ºC | | storage temp. | Storage temp. -20°C | | solubility | soluble in No data available | | pka | 2.56±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C4H3NO3/c6-4(7)3-5-1-2-8-3/h1-2H,(H,6,7) | | InChIKey | CQHYICHMGNSGQH-UHFFFAOYSA-N | | SMILES | O1C=CN=C1C(O)=O | | CAS DataBase Reference | 672948-03-7 |
| | 2-Oxazolecarboxylic acid Usage And Synthesis |
| Uses | 2-Oxazolecarboxylic acid is used as a reagent to prepare 3-(5-Chloro-2-furoyl)-3,7-diazabicyclo[3.3.0]octane, a highly selective α4β2 nicotinic Acetylcholine (A172060) receptor agonist used in the treatment of cognitive disorders such as Alzheimer’s disease. |
| | 2-Oxazolecarboxylic acid Preparation Products And Raw materials |
|