| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2-bromo-5-methyl-1,3,4-oxadiazole manufacturers
|
| | 2-bromo-5-methyl-1,3,4-oxadiazole Basic information | | Uses |
| | 2-bromo-5-methyl-1,3,4-oxadiazole Chemical Properties |
| Boiling point | 208.3±23.0 °C(Predicted) | | density | 1.788±0.06 g/cm3(Predicted) | | storage temp. | -20°C, stored under nitrogen | | pka | -5.78±0.32(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C3H3BrN2O/c1-2-5-6-3(4)7-2/h1H3 | | InChIKey | KLFIDXBWKMWDOF-UHFFFAOYSA-N | | SMILES | O1C(C)=NN=C1Br |
| HazardClass | IRRITANT | | HS Code | 2934999090 |
| | 2-bromo-5-methyl-1,3,4-oxadiazole Usage And Synthesis |
| Uses | 2-bromo-5-methyl-1,3,4-oxadiazole is a useful research chemical. |
| | 2-bromo-5-methyl-1,3,4-oxadiazole Preparation Products And Raw materials |
|