|
|
| | 2-METHOXY-5-NITRO-4-PICOLINE Basic information |
| Product Name: | 2-METHOXY-5-NITRO-4-PICOLINE | | Synonyms: | 2-METHOXY-5-NITRO-4-PICOLINE;2-Methoxy-5-nitro-4-methylprydine;2-Methoxy-5-nitro-3-methylpyridine;2-METHOXY-5-NITRO-4-ICOLINE;2-Methoxy-5-nitro-4-picoline ,99%;2-Metho×y-5-nitro-4-picoline;2-Methoxy-5-nitro-4-methylpyridine;2-METHOXY-5-NITRO-4-PICOLINE (2-METHOXY-4-METHYL-5-NITROPYRIDINE) | | CAS: | 6635-90-1 | | MF: | C7H8N2O3 | | MW: | 168.15 | | EINECS: | | | Product Categories: | Pyridines;Boronic Acid;Pyridine | | Mol File: | 6635-90-1.mol |  |
| | 2-METHOXY-5-NITRO-4-PICOLINE Chemical Properties |
| Melting point | 79.0 to 83.0 °C | | Boiling point | 280.3±35.0 °C(Predicted) | | density | 1.247±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 0.02±0.18(Predicted) | | form | Solid | | color | Pale Yellow to Pale Beige | | Water Solubility | Slightly soluble in water. | | InChI | 1S/C7H8N2O3/c1-5-3-7(12-2)8-4-6(5)9(10)11/h3-4H,1-2H3 | | InChIKey | DJNQRLCFAHKFLZ-UHFFFAOYSA-N | | SMILES | COc1cc(C)c(cn1)[N+]([O-])=O | | CAS DataBase Reference | 6635-90-1(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-41-37/38-22 | | Safety Statements | 26-37/39-39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | 2-METHOXY-5-NITRO-4-PICOLINE Usage And Synthesis |
| Chemical Properties | Off-white solid | | Uses | 2-Methoxy-4-methyl-5-nitropyridine is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields. |
| | 2-METHOXY-5-NITRO-4-PICOLINE Preparation Products And Raw materials |
|