|
|
| | 2,4,6-Tris(bromomethyl)mesitylene Basic information | | Uses |
| Product Name: | 2,4,6-Tris(bromomethyl)mesitylene | | Synonyms: | 1,3,5,5-TRIS(BROMOMETHYL)-2,4,6-TRIMETHYLBENZENE;1,3,5-tris(brommethyl)-2,4,6-trimethylbenzol;1,3,5-TRI(BROMOMETHYL)-2,4,6-TRIMETHYLBENZENE;1,3,5-TRIS(BROMOMETHYL)-2,4,6-TRIMETHYLBENZENE;2,4,6-TRIS(BROMOMETHYL)MESITYLENE;1,3,5-TRIS(BROMOMETHYL)-2,4,6-TRIMETHYLBENZENE 98+% T;2,4,6-Tris(bromomethyl)mesitylene 98%;2,4,6-Tribromomethyl-1,3,5-trimethylbenzene | | CAS: | 21988-87-4 | | MF: | C12H15Br3 | | MW: | 398.96 | | EINECS: | 244-697-1 | | Product Categories: | Aryl;C9 to C12;Halogenated Hydrocarbons;C9 to C12;Halogenated Hydrocarbons;Building Blocks;Chemical Synthesis;Organic Building Blocks | | Mol File: | 21988-87-4.mol |  |
| | 2,4,6-Tris(bromomethyl)mesitylene Chemical Properties |
| Melting point | 187-189 °C (lit.) | | Boiling point | 399.8±37.0 °C(Predicted) | | density | 1.759±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C12H15Br3/c1-7-10(4-13)8(2)12(6-15)9(3)11(7)5-14/h4-6H2,1-3H3 | | InChIKey | BHIFXIATEXVOQA-UHFFFAOYSA-N | | SMILES | C1(CBr)=C(C)C(CBr)=C(C)C(CBr)=C1C | | CAS DataBase Reference | 21988-87-4(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 20/21/22-34 | | Safety Statements | 22-26-27-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2903998090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| | 2,4,6-Tris(bromomethyl)mesitylene Usage And Synthesis |
| Uses | 2,4,6-Tribromomethyltrimethylbenzene is used as an organic building block and a general reagent. | | Synthesis | Under nitrogen atmosphere, 1,3,5-trimethylbenzene (0.7 mL, 5 mmol) was added to the reaction vial, followed by the sequential addition of acetic acid (2.6 mL) and 33% wt solution of hydrobromic acid acetic acid (3.5 mL). Next, paraformaldehyde (570 mg, 18.8 mmol, 3.7 equiv) was added. The reaction mixture was stirred at 95 °C. After 3 h, the solid was observed to start precipitating. Stirring of the reaction mixture was continued for 9 h, followed by cooling to room temperature. The reaction mixture was poured into ice water and the solid product was collected by filtration and dried. Recrystallization by mixed solvent recrystallization of dichloromethane and petroleum ether afforded the target compound 2,4,6-tribromomethyltrimethylbenzene as white needle-like crystals (1.99 g, 5 mmol, 99% yield).1H NMR (500 MHz, CDCl3) δ 4.61 (s, 6H), 2.50 (s, 9H).13C NMR (126 MHz, CDCl3) δ 137.84, 133.18, 29.93, 15.38. | | References | [1] Journal of Organic Chemistry, 1993, vol. 58, # 5, p. 1262 - 1263 [2] Patent: WO2018/106112, 2018, A1. Location in patent: Page/Page column 70 [3] Synthesis, 1994, # 11, p. 1132 - 1132 [4] Organic Letters, 2009, vol. 11, # 11, p. 2229 - 2232 [5] Tetrahedron Letters, 2013, vol. 54, # 8, p. 771 - 774 |
| | 2,4,6-Tris(bromomethyl)mesitylene Preparation Products And Raw materials |
|