| Company Name: |
Capot Chemical Co.,Ltd. |
| Tel: |
+86-(0)57185586718; +8613336195806 |
| Email: |
sales@capot.com |
| Products Intro: |
Product Name:2-Chloro-3-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyridine CAS:452972-11-1 Purity:98%(Min,GC) Package:100g;1kg;5kg,10kg,25kg,50kg
|
|
|
|
|
|
| | 2-CHLORO-3-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-PYRIDINE Basic information |
| Product Name: | 2-CHLORO-3-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-PYRIDINE | | Synonyms: | 2-CHLOROPYRIDINE-3-BORONIC ACID PINACOL ESTER;2-CHLORO-3-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-PYRIDINE;2-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 2-(2-Chloropyridin-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;2]dioxaborolan-2-yl)-pyridine;2-Chloro-3-(4;2-chloro-3-(tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine;2-CHLOROPYRIDIN-3-YLBORONIC ACID PINACOL ESTER;2-[(2-Chloro)pyridin-3-yl]-4,4',5,5'-tetramethyl-1,3-dioxaborolane | | CAS: | 452972-11-1 | | MF: | C11H15BClNO2 | | MW: | 239.51 | | EINECS: | | | Product Categories: | | | Mol File: | 452972-11-1.mol | ![2-CHLORO-3-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-PYRIDINE Structure](CAS/GIF/452972-11-1.gif) |
| | 2-CHLORO-3-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-PYRIDINE Chemical Properties |
| Melting point | 34-38 °C | | Boiling point | 335.1±27.0 °C(Predicted) | | density | 1.14±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Crystalline Powder | | pka | -0.27±0.10(Predicted) | | color | White to yellow to light brown | | InChI | 1S/C11H15BClNO2/c1-10(2)11(3,4)16-12(15-10)8-6-5-7-14-9(8)13/h5-7H,1-4H3 | | InChIKey | XFZFMAUUZHBQSS-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)c2cccnc2Cl | | CAS DataBase Reference | 452972-11-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29333999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 2-CHLORO-3-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-PYRIDINE Usage And Synthesis |
| Uses | 2-Chloropyridine-3-boronic acid, pinacol ester |
| | 2-CHLORO-3-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-PYRIDINE Preparation Products And Raw materials |
|