|
|
| | 2,4-Dibromo-5-hydroxybenzaldehyde Basic information |
| | 2,4-Dibromo-5-hydroxybenzaldehyde Chemical Properties |
| Melting point | 139 °C | | Boiling point | 303.4±42.0 °C(Predicted) | | density | 2.122±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 7.15±0.23(Predicted) | | form | powder | | color | Dark red/purple-brown | | InChI | InChI=1S/C7H4Br2O2/c8-5-2-6(9)7(11)1-4(5)3-10/h1-3,11H | | InChIKey | YYYLLTIYDVSUDA-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(O)=C(Br)C=C1Br |
| | 2,4-Dibromo-5-hydroxybenzaldehyde Usage And Synthesis |
| Uses | 2,4-Dibromo-5-hydroxybenzaldehyde, can be used in various chemical synthesis such as in the synthesis of LY-2801653, a c-Met receptor tyrosine kinase inhibitor. |
| | 2,4-Dibromo-5-hydroxybenzaldehyde Preparation Products And Raw materials |
|