| Company Name: |
Chengdu Kamel Pharmaceutical Co., Ltd Gold
|
| Tel: |
028-67136579 15828051124 |
| Email: |
sales@kamelpharm.com |
| Products Intro: |
Product Name:Octadecanoic acid,10-oxo-,methyl ester
CAS:870-10-0
Purity:98% Package:1G;5G;10G;20G;50G;100G;1KG;10KG Remarks:001044
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-66061636 19370895928 |
| Email: |
qqyang@aikonchem.com |
| Products Intro: |
Product Name:10-Oxostearic acid methyl ester
CAS:870-10-0
Purity:95+% Package:1g;5g;10g
|
| Company Name: |
Cato Research Chemicals Inc.
|
| Tel: |
020-81960175-877 18933936954 |
| Email: |
tianwen.zhan@cato-chem.com |
| Products Intro: |
Product Name:Methyl 10-oxooctadecanoate
CAS:870-10-0
Purity:99% HPLC Package:10mg;25mg;50mg;100mg
|
|
| | 10-Oxostearic acid methyl ester Basic information |
| Product Name: | 10-Oxostearic acid methyl ester | | Synonyms: | 10-Oxooctadecanoic acid methyl ester;10-Oxostearic acid methyl ester;Methyl 10-ketostearate;Octadecanoic acid,10-oxo-,methyl ester | | CAS: | 870-10-0 | | MF: | C19H36O3 | | MW: | 312.49 | | EINECS: | | | Product Categories: | | | Mol File: | 870-10-0.mol |  |
| | 10-Oxostearic acid methyl ester Chemical Properties |
| Melting point | 46-47 °C | | Boiling point | 407.8±28.0 °C(Predicted) | | density | 0.911±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C19H36O3/c1-3-4-5-6-9-12-15-18(20)16-13-10-7-8-11-14-17-19(21)22-2/h3-17H2,1-2H3 | | InChIKey | YZQUPDATKHOMLU-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CCCCCCCCC(=O)CCCCCCCC |
| | 10-Oxostearic acid methyl ester Usage And Synthesis |
| | 10-Oxostearic acid methyl ester Preparation Products And Raw materials |
|