- 1-METHYLBENZOTRIAZOLE
-
- $0.00 / 1KG
-
2025-09-23
- CAS:13351-73-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 2000
- 1-METHYLBENZOTRIAZOLE
-
- $15.00 / 1KG
-
2021-08-12
- CAS:13351-73-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- 1-Methyl-1H-benzotriazole
-
- $15.00 / 1KG
-
2021-07-02
- CAS:13351-73-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 1-METHYLBENZOTRIAZOLE Basic information |
| Product Name: | 1-METHYLBENZOTRIAZOLE | | Synonyms: | 1H-Benzotriazole, 1-methyl-;1H-Benzotriazole,1-methyl-;1-Methyl-1,2,3-benzotriazole;1-Methyl-1H-1,2,3-benzotriazole;1-methyl-1h-benzotriazol;1-METHYL-1H-BENZOTRIAZOLE;1-METHYLBENZOTRIAZOLE;METHYLBENZOTRIAZOLE | | CAS: | 13351-73-0 | | MF: | C7H7N3 | | MW: | 133.15 | | EINECS: | 236-401-4 | | Product Categories: | | | Mol File: | 13351-73-0.mol |  |
| | 1-METHYLBENZOTRIAZOLE Chemical Properties |
| Melting point | 64-65°C | | Boiling point | 155°C/17mmHg(lit.) | | density | 1.1873 (rough estimate) | | refractive index | 1.5341 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform, Methanol (Sparingly) | | form | Solid | | pka | 1.40±0.30(Predicted) | | color | White to Pale Beige | | λmax | 285nm(Cyclohexane)(lit.) | | BRN | 118900 | | InChI | InChI=1S/C7H7N3/c1-10-7-5-3-2-4-6(7)8-9-10/h2-5H,1H3 | | InChIKey | HXQHRUJXQJEGER-UHFFFAOYSA-N | | SMILES | N1(C)C2=CC=CC=C2N=N1 | | CAS DataBase Reference | 13351-73-0(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | RTECS | DM1330000 | | HazardClass | IRRITANT | | HS Code | 2933998090 |
| Provider | Language |
|
ALFA
| English |
| | 1-METHYLBENZOTRIAZOLE Usage And Synthesis |
| Uses | A benzotriazole derivative with potential inhibitory effect on protease enzymes chymotrypsin, trypsin and papain. |
| | 1-METHYLBENZOTRIAZOLE Preparation Products And Raw materials |
|