|
|
| | 4-AMINO-2-CHLORO-5-IODOPYRIMIDINE Basic information |
| | 4-AMINO-2-CHLORO-5-IODOPYRIMIDINE Chemical Properties |
| Melting point | 191-192 °C | | Boiling point | 397.1±27.0 °C(Predicted) | | density | 2.276±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | pka | 0.78±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C4H3ClIN3/c5-4-8-1-2(6)3(7)9-4/h1H,(H2,7,8,9) | | InChIKey | RAMOUFDZSBRIGR-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(I)C(N)=N1 |
| Risk Statements | 41 | | Safety Statements | 26-39 |
| | 4-AMINO-2-CHLORO-5-IODOPYRIMIDINE Usage And Synthesis |
| | 4-AMINO-2-CHLORO-5-IODOPYRIMIDINE Preparation Products And Raw materials |
|