|
|
| | 4-Hydroxybenzoic acid 2-hydroxypropyl ester Basic information |
| | 4-Hydroxybenzoic acid 2-hydroxypropyl ester Chemical Properties |
| InChI | InChI=1S/C10H12O4/c1-7(11)6-14-10(13)8-2-4-9(12)5-3-8/h2-5,7,11-12H,6H2,1H3 | | InChIKey | HSFHQJDXOFHWNQ-UHFFFAOYSA-N | | SMILES | C(OCC(O)C)(=O)C1=CC=C(O)C=C1 |
| | 4-Hydroxybenzoic acid 2-hydroxypropyl ester Usage And Synthesis |
| Uses | 2-Hydroxypropyl-4-hydroxybenzoate can be useful in HPLC and LC-MS studies of the transesterification reaction of methylparaben with twelve 3- to 6-carbon sugar alcohols and propylene glycol and the isomerization of the reaction products by acyl migration. |
| | 4-Hydroxybenzoic acid 2-hydroxypropyl ester Preparation Products And Raw materials |
|