|
|
| | 1-Bromo-2-chloro-4-fluorobenzene Basic information |
| | 1-Bromo-2-chloro-4-fluorobenzene Chemical Properties |
| Boiling point | 62-62.8 °C(Press: 12 Torr) | | density | 1.75 | | refractive index | 1.5525 | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C6H3BrClF/c7-5-2-1-4(9)3-6(5)8/h1-3H | | InChIKey | LEFQPBAWVJEIJS-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(F)C=C1Cl | | CAS DataBase Reference | 110407-59-5(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-36-22 | | Safety Statements | 26-36/37/39-37 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 29039990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| Provider | Language |
|
ALFA
| English |
| | 1-Bromo-2-chloro-4-fluorobenzene Usage And Synthesis |
| Uses | 1-Bromo-2-chloro-4-fluorobenzene is a component of polyhalogenated benzenes and has a wide range of applications in organic synthesis, medicinal chemistry, and biochemical research. |
| | 1-Bromo-2-chloro-4-fluorobenzene Preparation Products And Raw materials |
|