|
|
| | 4-[Methyl[(2-amino-4-hydroxypteridine)-6-ylmethyl]amino]benzoic acid Basic information |
| | 4-[Methyl[(2-amino-4-hydroxypteridine)-6-ylmethyl]amino]benzoic acid Chemical Properties |
| Melting point | >245°C (dec.) | | Boiling point | 583.7±60.0 °C(Predicted) | | density | 1.58±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Aqueous Base (Slightly), DMSO (Very Slightly, Heated), Methanol (Very Slightly) | | pka | 4.74±0.10(Predicted) | | color | Orange to Red | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C15H14N6O3/c1-21(10-4-2-8(3-5-10)14(23)24)7-9-6-17-12-11(18-9)13(22)20-15(16)19-12/h2-6H,7H2,1H3,(H,23,24)(H3,16,17,19,20,22) | | InChIKey | QHNLFEQJGRZKTK-UHFFFAOYSA-N | | SMILES | [nH]1c2nc(n[c](c2nc(c1)CN(C)c3ccc(cc3)C(=O)O)=O)N |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4-[Methyl[(2-amino-4-hydroxypteridine)-6-ylmethyl]amino]benzoic acid Usage And Synthesis |
| Chemical Properties | Dark Orange Solid | | Uses | N10-Methyl Pteroic Acid (Methotrexate EP Impurity D) is a Methotrexate (M260675) impurity D. | | Uses | Methotrexate (M260675) impurity D. |
| | 4-[Methyl[(2-amino-4-hydroxypteridine)-6-ylmethyl]amino]benzoic acid Preparation Products And Raw materials |
|