- 6-Fluoronicotinaldehyde
-
- $200.00 / 1KG
-
2025-09-25
- CAS:677728-92-6
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-Fluoropyridine-5-carboxaldehyde Basic information |
| | 2-Fluoropyridine-5-carboxaldehyde Chemical Properties |
| Boiling point | 229.0±20.0 °C(Predicted) | | density | 1.269±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -2.23±0.10(Predicted) | | form | fused solid | | color | White | | InChI | InChI=1S/C6H4FNO/c7-6-2-1-5(4-9)3-8-6/h1-4H | | InChIKey | PZPNGWWKCSJKOS-UHFFFAOYSA-N | | SMILES | C1=NC(F)=CC=C1C=O |
| Hazard Codes | Xi | | RIDADR | 1993 | | Hazard Note | Irritant | | HazardClass | 3 | | PackingGroup | Ⅲ | | HS Code | 2933399990 |
| | 2-Fluoropyridine-5-carboxaldehyde Usage And Synthesis |
| Chemical Properties | White solid, not very stable at room temperature. | | Uses | 6-Fluoro-3-pyridinecarboxaldehyde is used in the synthetic preparation of biheteroaryl arylamines as selective inhibitors of phosphoinositol 3-kinases (PI3K), which are selective for PI3K over mTOR and have potential use as antitumor agents. |
| | 2-Fluoropyridine-5-carboxaldehyde Preparation Products And Raw materials |
|