| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | Spiro[5.5]undecan-2-one Basic information |
| | Spiro[5.5]undecan-2-one Chemical Properties |
| Boiling point | 225 °C(Press: 772 Torr) | | density | 0.98417 g/cm3(Temp: 21-27 °C) | | storage temp. | Store at room temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C11H18O/c12-10-5-4-8-11(9-10)6-2-1-3-7-11/h1-9H2 | | InChIKey | FEYUTRZPSFLEST-UHFFFAOYSA-N | | SMILES | C1C2(CCCCC2)CCCC1=O |
| | Spiro[5.5]undecan-2-one Usage And Synthesis |
| Uses | Spiro[5.5]undecan-2-one is used in the preparation of commonly encountered spirocyclic systems. | | Synthesis Reference(s) | Journal of the American Chemical Society, 110, p. 2218, 1988 DOI: 10.1021/ja00215a035 |
| | Spiro[5.5]undecan-2-one Preparation Products And Raw materials |
|